C25H29N5O — CID 70658290
4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide (PubChem CID 70658290) has the molecular formula C25H29N5O and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide.
| Compound Name | 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide |
|---|---|
| PubChem CID | 70658290 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide |
| SMILES | Cc1c(-c2ccccc2)nnc(N2CCC(N(C)C(=O)c3ccc(N)cc3)CC2)c1C |
| InChI | InChI=1S/C25H29N5O/c1-17-18(2)24(28-27-23(17)19-7-5-4-6-8-19)30-15-13-22(14-16-30)29(3)25(31)20-9-11-21(26)12-10-20/h4-12,22H,13-16,26H2,1-3H3 |
| InChIKey | UVIWLVWZFNFUEJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|