About 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide
4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide (PubChem CID 70658290) has the molecular formula C25H29N5O
and a molecular weight of 415.54 g/mol. Its IUPAC name is 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide.
Molecular Properties
| Compound Name | 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide |
| PubChem CID | 70658290 |
| Molecular Formula | C25H29N5O |
| Molecular Weight | 415.54 g/mol |
| Exact Mass | 415.24 |
| IUPAC Name | 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide |
| SMILES | Cc1c(-c2ccccc2)nnc(N2CCC(N(C)C(=O)c3ccc(N)cc3)CC2)c1C |
| InChI | InChI=1S/C25H29N5O/c1-17-18(2)24(28-27-23(17)19-7-5-4-6-8-19)30-15-13-22(14-16-30)29(3)25(31)20-9-11-21(26)12-10-20/h4-12,22H,13-16,26H2,1-3H3 |
| InChIKey | UVIWLVWZFNFUEJ-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 415.54 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide?
The IUPAC name of 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide (CID 70658290) is 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide.
What is the SMILES notation for 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide?
The canonical SMILES for 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide is Cc1c(-c2ccccc2)nnc(N2CCC(N(C)C(=O)c3ccc(N)cc3)CC2)c1C.
What is the InChIKey of 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide?
The InChIKey is UVIWLVWZFNFUEJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C25H29N5O/c1-17-18(2)24(28-27-23(17)19-7-5-4-6-8-19)30-15-13-22(14-16-30)29(3)25(31)20-9-11-21(26)12-10-20/h4-12,22H,13-16,26H2,1-3H3.
What are the key properties of 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide?
4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide has a molecular weight of 415.54 g/mol, XLogP of 4.08, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-N-[1-(4,5-dimethyl-6-phenylpyridazin-3-yl)piperidin-4-yl]-N-methylbenzamide is sourced from PubChem (CID 70658290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).