C28H50O — CID 70658335
(2S,4aR)-4a-methyl-6-[(2R,3R)-2-methyl-3-(6-methylheptan-2-yl)-2-propylcyclopentyl]-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol (PubChem CID 70658335) has the molecular formula C28H50O and a molecular weight of 402.71 g/mol. Its IUPAC name is (2S,4aR)-4a-methyl-6-[(2R,3R)-2-methyl-3-(6-methylheptan-2-yl)-2-propylcyclopentyl]-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol.
| Compound Name | (2S,4aR)-4a-methyl-6-[(2R,3R)-2-methyl-3-(6-methylheptan-2-yl)-2-propylcyclopentyl]-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
|---|---|
| PubChem CID | 70658335 |
| Molecular Formula | C28H50O |
| Molecular Weight | 402.71 g/mol |
| Exact Mass | 402.39 |
| IUPAC Name | (2S,4aR)-4a-methyl-6-[(2R,3R)-2-methyl-3-(6-methylheptan-2-yl)-2-propylcyclopentyl]-2,3,4,5,6,7-hexahydro-1H-naphthalen-2-ol |
| SMILES | CCC[C@@]1(C)C(C2CC=C3C[C@@H](O)CC[C@]3(C)C2)CC[C@@H]1C(C)CCCC(C)C |
| InChI | InChI=1S/C28H50O/c1-7-16-28(6)25(21(4)10-8-9-20(2)3)13-14-26(28)22-11-12-23-18-24(29)15-17-27(23,5)19-22/h12,20-22,24-26,29H,7-11,13-19H2,1-6H3/t21?,22?,24-,25+,26?,27+,28+/m0/s1 |
| InChIKey | DVZVOXNJJKIZJD-AILJYLHDSA-N |
| XLogP | 8.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.71 |
| LogP ≤ 5 | 8.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|