C13H17N — CID 70658369
(9bS)-8-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine (PubChem CID 70658369) has the molecular formula C13H17N and a molecular weight of 187.29 g/mol. Its IUPAC name is (9bS)-8-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine.
| Compound Name | (9bS)-8-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
|---|---|
| PubChem CID | 70658369 |
| Molecular Formula | C13H17N |
| Molecular Weight | 187.29 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | (9bS)-8-methyl-2,3,4,4a,5,9b-hexahydro-1H-indeno[1,2-b]pyridine |
| SMILES | Cc1ccc2c(c1)[C@H]1NCCCC1C2 |
| InChI | InChI=1S/C13H17N/c1-9-4-5-10-8-11-3-2-6-14-13(11)12(10)7-9/h4-5,7,11,13-14H,2-3,6,8H2,1H3/t11?,13-/m0/s1 |
| InChIKey | VSVBOFKDUIODGF-YUZLPWPTSA-N |
| XLogP | 2.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.29 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |