C14H19N — CID 70658400
(4aR,9S,9aS)-9-methyl-1,2,3,4,4a,9a-hexahydrofluoren-9-amine (PubChem CID 70658400) has the molecular formula C14H19N and a molecular weight of 201.31 g/mol. Its IUPAC name is (4aR,9S,9aS)-9-methyl-1,2,3,4,4a,9a-hexahydrofluoren-9-amine.
| Compound Name | (4aR,9S,9aS)-9-methyl-1,2,3,4,4a,9a-hexahydrofluoren-9-amine |
|---|---|
| PubChem CID | 70658400 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | (4aR,9S,9aS)-9-methyl-1,2,3,4,4a,9a-hexahydrofluoren-9-amine |
| SMILES | C[C@@]1(N)c2ccccc2[C@@H]2CCCC[C@@H]21 |
| InChI | InChI=1S/C14H19N/c1-14(15)12-8-4-2-6-10(12)11-7-3-5-9-13(11)14/h2,4,6,8,11,13H,3,5,7,9,15H2,1H3/t11-,13-,14+/m0/s1 |
| InChIKey | MFIUUYLNYNJWFW-FPMFFAJLSA-N |
| XLogP | 3.15 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |