About 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine
1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine (PubChem CID 70658456) has the molecular formula C14H19N
and a molecular weight of 201.31 g/mol. Its IUPAC name is 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine.
Molecular Properties
| Compound Name | 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine |
| PubChem CID | 70658456 |
| Molecular Formula | C14H19N |
| Molecular Weight | 201.31 g/mol |
| Exact Mass | 201.15 |
| IUPAC Name | 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine |
| SMILES | CC(C)(C)C(N)c1ccc2c(c1)C=CC2 |
| InChI | InChI=1S/C14H19N/c1-14(2,3)13(15)12-8-7-10-5-4-6-11(10)9-12/h4,6-9,13H,5,15H2,1-3H3 |
| InChIKey | TVRJETFMGTZLEE-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.31 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine?
The IUPAC name of 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine (CID 70658456) is 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine.
What is the SMILES notation for 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine?
The canonical SMILES for 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine is CC(C)(C)C(N)c1ccc2c(c1)C=CC2.
What is the InChIKey of 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine?
The InChIKey is TVRJETFMGTZLEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H19N/c1-14(2,3)13(15)12-8-7-10-5-4-6-11(10)9-12/h4,6-9,13H,5,15H2,1-3H3.
What are the key properties of 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine?
1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine has a molecular weight of 201.31 g/mol, XLogP of 3.30, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1H-inden-5-yl)-2,2-dimethylpropan-1-amine is sourced from PubChem (CID 70658456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).