C19H31NO6 — CID 70658474
methyl (1S,2S,4S,6R,9S)-4-butoxy-9-butyl-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 70658474) has the molecular formula C19H31NO6 and a molecular weight of 369.46 g/mol. Its IUPAC name is methyl (1S,2S,4S,6R,9S)-4-butoxy-9-butyl-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1S,2S,4S,6R,9S)-4-butoxy-9-butyl-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 70658474 |
| Molecular Formula | C19H31NO6 |
| Molecular Weight | 369.46 g/mol |
| Exact Mass | 369.22 |
| IUPAC Name | methyl (1S,2S,4S,6R,9S)-4-butoxy-9-butyl-2-methyl-7-oxo-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | CCCCO[C@@H]1C[C@H]2C(=O)N3[C@H](CCCC)OC[C@@]3(C(=O)OC)[C@@]2(C)O1 |
| InChI | InChI=1S/C19H31NO6/c1-5-7-9-14-20-16(21)13-11-15(24-10-8-6-2)26-18(13,3)19(20,12-25-14)17(22)23-4/h13-15H,5-12H2,1-4H3/t13-,14-,15-,18-,19+/m0/s1 |
| InChIKey | JGDTYXONRCVFFU-UNTXSKPGSA-N |
| XLogP | 2.22 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.46 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|