About N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide
N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide (PubChem CID 70658762) has the molecular formula C6H7ClN2OS
and a molecular weight of 190.66 g/mol. Its IUPAC name is N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide.
Molecular Properties
| Compound Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide |
| PubChem CID | 70658762 |
| Molecular Formula | C6H7ClN2OS |
| Molecular Weight | 190.66 g/mol |
| Exact Mass | 190.00 |
| IUPAC Name | N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide |
| SMILES | CC(=O)NCc1cnc(Cl)s1 |
| InChI | InChI=1S/C6H7ClN2OS/c1-4(10)8-2-5-3-9-6(7)11-5/h3H,2H2,1H3,(H,8,10) |
| InChIKey | WMLUVHKQMOUXKF-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.66 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide?
The IUPAC name of N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide (CID 70658762) is N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide.
What is the SMILES notation for N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide?
The canonical SMILES for N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide is CC(=O)NCc1cnc(Cl)s1.
What is the InChIKey of N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide?
The InChIKey is WMLUVHKQMOUXKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7ClN2OS/c1-4(10)8-2-5-3-9-6(7)11-5/h3H,2H2,1H3,(H,8,10).
What are the key properties of N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide?
N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide has a molecular weight of 190.66 g/mol, XLogP of 1.43, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2-chloro-1,3-thiazol-5-yl)methyl]acetamide is sourced from PubChem (CID 70658762), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).