C22H36F2O3 — CID 70658829
methyl 7-[(1S,2R,5S)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-methylcyclopentyl]heptanoate (PubChem CID 70658829) has the molecular formula C22H36F2O3 and a molecular weight of 386.52 g/mol. Its IUPAC name is methyl 7-[(1S,2R,5S)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-methylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2R,5S)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-methylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70658829 |
| Molecular Formula | C22H36F2O3 |
| Molecular Weight | 386.52 g/mol |
| Exact Mass | 386.26 |
| IUPAC Name | methyl 7-[(1S,2R,5S)-2-[(E)-4,4-difluoro-3-oxooct-1-enyl]-5-methylcyclopentyl]heptanoate |
| SMILES | CCCCC(F)(F)C(=O)/C=C/[C@H]1CC[C@H](C)[C@@H]1CCCCCCC(=O)OC |
| InChI | InChI=1S/C22H36F2O3/c1-4-5-16-22(23,24)20(25)15-14-18-13-12-17(2)19(18)10-8-6-7-9-11-21(26)27-3/h14-15,17-19H,4-13,16H2,1-3H3/b15-14+/t17-,18+,19-/m0/s1 |
| InChIKey | PMSTWOKIVLVTIN-YWHJBLDPSA-N |
| XLogP | 6.11 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|