C21H42O3Si — CID 70658850
methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylcyclopentyl]heptanoate (PubChem CID 70658850) has the molecular formula C21H42O3Si and a molecular weight of 370.65 g/mol. Its IUPAC name is methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylcyclopentyl]heptanoate.
| Compound Name | methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylcyclopentyl]heptanoate |
|---|---|
| PubChem CID | 70658850 |
| Molecular Formula | C21H42O3Si |
| Molecular Weight | 370.65 g/mol |
| Exact Mass | 370.29 |
| IUPAC Name | methyl 7-[(1S,2S,5S)-2-[[tert-butyl(dimethyl)silyl]oxymethyl]-5-methylcyclopentyl]heptanoate |
| SMILES | COC(=O)CCCCCC[C@@H]1[C@@H](CO[Si](C)(C)C(C)(C)C)CC[C@@H]1C |
| InChI | InChI=1S/C21H42O3Si/c1-17-14-15-18(16-24-25(6,7)21(2,3)4)19(17)12-10-8-9-11-13-20(22)23-5/h17-19H,8-16H2,1-7H3/t17-,18+,19-/m0/s1 |
| InChIKey | VUJVNGQCYBLPSH-OTWHNJEPSA-N |
| XLogP | 6.18 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.65 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|