C15H21ClNO2+ — CID 7065935
[(2R,4S,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl] 2-chlorobenzoate (PubChem CID 7065935) has the molecular formula C15H21ClNO2+ and a molecular weight of 282.79 g/mol. Its IUPAC name is [(2R,4S,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl] 2-chlorobenzoate.
| Compound Name | [(2R,4S,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl] 2-chlorobenzoate |
|---|---|
| PubChem CID | 7065935 |
| Molecular Formula | C15H21ClNO2+ |
| Molecular Weight | 282.79 g/mol |
| Exact Mass | 282.13 |
| IUPAC Name | [(2R,4S,5R)-1,2,5-trimethylpiperidin-1-ium-4-yl] 2-chlorobenzoate |
| SMILES | C[C@@H]1C[NH+](C)[C@H](C)C[C@@H]1OC(=O)c1ccccc1Cl |
| InChI | InChI=1S/C15H20ClNO2/c1-10-9-17(3)11(2)8-14(10)19-15(18)12-6-4-5-7-13(12)16/h4-7,10-11,14H,8-9H2,1-3H3/p+1/t10-,11-,14+/m1/s1 |
| InChIKey | LGWYXROPIZJPDW-GYSYKLTISA-O |
| XLogP | 1.81 |
| TPSA | 30.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.79 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |