C37H49N5O4 — CID 70660070
1,5-dimethyl-7-[5-[(2-methylphenyl)methyl-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl]amino]pentoxy]-1,5-benzodiazepine-2,4-dione (PubChem CID 70660070) has the molecular formula C37H49N5O4 and a molecular weight of 627.83 g/mol. Its IUPAC name is 1,5-dimethyl-7-[5-[(2-methylphenyl)methyl-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl]amino]pentoxy]-1,5-benzodiazepine-2,4-dione.
| Compound Name | 1,5-dimethyl-7-[5-[(2-methylphenyl)methyl-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl]amino]pentoxy]-1,5-benzodiazepine-2,4-dione |
|---|---|
| PubChem CID | 70660070 |
| Molecular Formula | C37H49N5O4 |
| Molecular Weight | 627.83 g/mol |
| Exact Mass | 627.38 |
| IUPAC Name | 1,5-dimethyl-7-[5-[(2-methylphenyl)methyl-[2-[4-(pyridin-3-ylmethoxy)piperidin-1-yl]ethyl]amino]pentoxy]-1,5-benzodiazepine-2,4-dione |
| SMILES | Cc1ccccc1CN(CCCCCOc1ccc2c(c1)N(C)C(=O)CC(=O)N2C)CCN1CCC(OCc2cccnc2)CC1 |
| InChI | InChI=1S/C37H49N5O4/c1-29-10-5-6-12-31(29)27-42(22-21-41-19-15-32(16-20-41)46-28-30-11-9-17-38-26-30)18-7-4-8-23-45-33-13-14-34-35(24-33)40(3)37(44)25-36(43)39(34)2/h5-6,9-14,17,24,26,32H,4,7-8,15-16,18-23,25,27-28H2,1-3H3 |
| InChIKey | UYJUNZFYZCPEFT-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 78.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.83 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|