C34H20Cl2F2N6 — CID 70660108
4-N,5-N-bis[2-(5-chloro-2-fluorophenyl)quinolin-4-yl]pyridazine-4,5-diamine (PubChem CID 70660108) has the molecular formula C34H20Cl2F2N6 and a molecular weight of 621.48 g/mol. Its IUPAC name is 4-N,5-N-bis[2-(5-chloro-2-fluorophenyl)quinolin-4-yl]pyridazine-4,5-diamine.
| Compound Name | 4-N,5-N-bis[2-(5-chloro-2-fluorophenyl)quinolin-4-yl]pyridazine-4,5-diamine |
|---|---|
| PubChem CID | 70660108 |
| Molecular Formula | C34H20Cl2F2N6 |
| Molecular Weight | 621.48 g/mol |
| Exact Mass | 620.11 |
| IUPAC Name | 4-N,5-N-bis[2-(5-chloro-2-fluorophenyl)quinolin-4-yl]pyridazine-4,5-diamine |
| SMILES | Fc1ccc(Cl)cc1-c1cc(Nc2cnncc2Nc2cc(-c3cc(Cl)ccc3F)nc3ccccc23)c2ccccc2n1 |
| InChI | InChI=1S/C34H20Cl2F2N6/c35-19-9-11-25(37)23(13-19)31-15-29(21-5-1-3-7-27(21)41-31)43-33-17-39-40-18-34(33)44-30-16-32(24-14-20(36)10-12-26(24)38)42-28-8-4-2-6-22(28)30/h1-18H,(H,40,41,43)(H,39,42,44) |
| InChIKey | DHXAHRHIYFFZMB-UHFFFAOYSA-N |
| XLogP | 9.98 |
| TPSA | 75.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.48 |
| LogP ≤ 5 | 9.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |