C17H18F3N7S — CID 70660407
N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 70660407) has the molecular formula C17H18F3N7S and a molecular weight of 409.44 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 70660407 |
| Molecular Formula | C17H18F3N7S |
| Molecular Weight | 409.44 g/mol |
| Exact Mass | 409.13 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-7-(trifluoromethyl)-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3cc(C(F)(F)F)ccn3n2)n1 |
| InChI | InChI=1S/C17H18F3N7S/c1-9-21-16(28-25-9)26-7-10-2-3-11(8-26)14(10)23-15-22-13-6-12(17(18,19)20)4-5-27(13)24-15/h4-6,10-11,14H,2-3,7-8H2,1H3,(H,23,24)/t10-,11+,14? |
| InChIKey | PISFLYAGRSLZGX-BVUQATHDSA-N |
| XLogP | 3.23 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.44 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |