C23H28F3N7S — CID 70660408
N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine (PubChem CID 70660408) has the molecular formula C23H28F3N7S and a molecular weight of 491.59 g/mol. Its IUPAC name is N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine.
| Compound Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
|---|---|
| PubChem CID | 70660408 |
| Molecular Formula | C23H28F3N7S |
| Molecular Weight | 491.59 g/mol |
| Exact Mass | 491.21 |
| IUPAC Name | N-[(1S,5R)-3-(3-methyl-1,2,4-thiadiazol-5-yl)-3-azabicyclo[3.2.1]octan-8-yl]-8-[4-(trifluoromethyl)cyclohexyl]-[1,2,4]triazolo[1,5-a]pyridin-2-amine |
| SMILES | Cc1nsc(N2C[C@H]3CC[C@@H](C2)C3Nc2nc3c(C4CCC(C(F)(F)F)CC4)cccn3n2)n1 |
| InChI | InChI=1S/C23H28F3N7S/c1-13-27-22(34-31-13)32-11-15-4-5-16(12-32)19(15)28-21-29-20-18(3-2-10-33(20)30-21)14-6-8-17(9-7-14)23(24,25)26/h2-3,10,14-17,19H,4-9,11-12H2,1H3,(H,28,30)/t14?,15-,16+,17?,19? |
| InChIKey | LADDVEUYAPMKMZ-PVOWQQPYSA-N |
| XLogP | 5.05 |
| TPSA | 71.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.59 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |