About 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one
4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one (PubChem CID 70660595) has the molecular formula C19H38N2O4
and a molecular weight of 358.52 g/mol. Its IUPAC name is 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one.
Molecular Properties
| Compound Name | 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one |
| PubChem CID | 70660595 |
| Molecular Formula | C19H38N2O4 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.28 |
| IUPAC Name | 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one |
| SMILES | CC(=O)CCOCCOCCOCCN1CCN(CC(C)(C)C)CC1 |
| InChI | InChI=1S/C19H38N2O4/c1-18(22)5-11-23-13-15-25-16-14-24-12-10-20-6-8-21(9-7-20)17-19(2,3)4/h5-17H2,1-4H3 |
| InChIKey | ZSOUNNNGZNZRBR-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 51.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one?
The IUPAC name of 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one (CID 70660595) is 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one.
What is the SMILES notation for 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one?
The canonical SMILES for 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one is CC(=O)CCOCCOCCOCCN1CCN(CC(C)(C)C)CC1.
What is the InChIKey of 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one?
The InChIKey is ZSOUNNNGZNZRBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H38N2O4/c1-18(22)5-11-23-13-15-25-16-14-24-12-10-20-6-8-21(9-7-20)17-19(2,3)4/h5-17H2,1-4H3.
What are the key properties of 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one?
4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one has a molecular weight of 358.52 g/mol, XLogP of 1.68, 13 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[2-[2-[2-[4-(2,2-dimethylpropyl)piperazin-1-yl]ethoxy]ethoxy]ethoxy]butan-2-one is sourced from PubChem (CID 70660595), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).