C30H45NO10 — CID 70661353
[(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate (PubChem CID 70661353) has the molecular formula C30H45NO10 and a molecular weight of 579.69 g/mol. Its IUPAC name is [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 70661353 |
| Molecular Formula | C30H45NO10 |
| Molecular Weight | 579.69 g/mol |
| Exact Mass | 579.30 |
| IUPAC Name | [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CC(=O)OC1[C@H](O[C@@H]2CO[C@@H](OCCCCCNC(=O)OCc3ccccc3)C(OC(C)=O)[C@H]2C)OC[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C30H45NO10/c1-19-16-36-29(26(20(19)2)39-22(4)32)41-25-18-37-28(27(21(25)3)40-23(5)33)35-15-11-7-10-14-31-30(34)38-17-24-12-8-6-9-13-24/h6,8-9,12-13,19-21,25-29H,7,10-11,14-18H2,1-5H3,(H,31,34)/t19-,20+,21+,25-,26?,27?,28-,29+/m1/s1 |
| InChIKey | ARDBRQYPZOXTNI-IXVVRMFISA-N |
| XLogP | 3.97 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.69 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|