C34H53NO10 — CID 70661357
[(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-2-ethyl-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate (PubChem CID 70661357) has the molecular formula C34H53NO10 and a molecular weight of 635.80 g/mol. Its IUPAC name is [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-2-ethyl-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate.
| Compound Name | [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-2-ethyl-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
|---|---|
| PubChem CID | 70661357 |
| Molecular Formula | C34H53NO10 |
| Molecular Weight | 635.80 g/mol |
| Exact Mass | 635.37 |
| IUPAC Name | [(2S,4S,5S)-2-[(3S,4S,6R)-5-acetyloxy-2-ethyl-4-methyl-6-[5-(phenylmethoxycarbonylamino)pentoxy]oxan-3-yl]oxy-6-ethyl-4,5-dimethyloxan-3-yl] acetate |
| SMILES | CCC1O[C@@H](O[C@@H]2C(CC)O[C@@H](OCCCCCNC(=O)OCc3ccccc3)C(OC(C)=O)[C@H]2C)C(OC(C)=O)[C@@H](C)[C@@H]1C |
| InChI | InChI=1S/C34H53NO10/c1-8-27-21(3)22(4)30(41-24(6)36)33(43-27)45-29-23(5)31(42-25(7)37)32(44-28(29)9-2)39-19-15-11-14-18-35-34(38)40-20-26-16-12-10-13-17-26/h10,12-13,16-17,21-23,27-33H,8-9,11,14-15,18-20H2,1-7H3,(H,35,38)/t21-,22-,23-,27?,28?,29-,30?,31?,32+,33-/m0/s1 |
| InChIKey | RHADDRQCUOGTJK-YZROQSOPSA-N |
| XLogP | 5.53 |
| TPSA | 127.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 635.80 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|