About tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate
tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 70661546) has the molecular formula C17H30N2O3
and a molecular weight of 310.44 g/mol. Its IUPAC name is tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 70661546 |
| Molecular Formula | C17H30N2O3 |
| Molecular Weight | 310.44 g/mol |
| Exact Mass | 310.23 |
| IUPAC Name | tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(OC1CCNCC1)C2 |
| InChI | InChI=1S/C17H30N2O3/c1-17(2,3)22-16(20)19-12-4-5-13(19)11-15(10-12)21-14-6-8-18-9-7-14/h12-15,18H,4-11H2,1-3H3/t12-,13+,15? |
| InChIKey | XGFGIGCCYPNJBY-NNQSOWQGSA-N |
| XLogP | 2.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 310.44 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 70661546) is tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate is CC(C)(C)OC(=O)N1[C@@H]2CC[C@H]1CC(OC1CCNCC1)C2.
What is the InChIKey of tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is XGFGIGCCYPNJBY-NNQSOWQGSA-N. The full InChI is InChI=1S/C17H30N2O3/c1-17(2,3)22-16(20)19-12-4-5-13(19)11-15(10-12)21-14-6-8-18-9-7-14/h12-15,18H,4-11H2,1-3H3/t12-,13+,15?.
What are the key properties of tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate?
tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 310.44 g/mol, XLogP of 2.69, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1S,5R)-3-piperidin-4-yloxy-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 70661546), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).