About tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate
tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate (PubChem CID 70661600) has the molecular formula C20H26FNO5
and a molecular weight of 379.43 g/mol. Its IUPAC name is tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate.
Molecular Properties
| Compound Name | tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| PubChem CID | 70661600 |
| Molecular Formula | C20H26FNO5 |
| Molecular Weight | 379.43 g/mol |
| Exact Mass | 379.18 |
| IUPAC Name | tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate |
| SMILES | COC(=O)c1cc(F)cc(OC2C[C@H]3CC[C@@H](C2)N3C(=O)OC(C)(C)C)c1 |
| InChI | InChI=1S/C20H26FNO5/c1-20(2,3)27-19(24)22-14-5-6-15(22)11-17(10-14)26-16-8-12(18(23)25-4)7-13(21)9-16/h7-9,14-15,17H,5-6,10-11H2,1-4H3/t14-,15+,17? |
| InChIKey | BWSLBNYBMHLMPP-FKEKPDDDSA-N |
| XLogP | 3.92 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 379.43 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The IUPAC name of tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate (CID 70661600) is tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate.
What is the SMILES notation for tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The canonical SMILES for tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate is COC(=O)c1cc(F)cc(OC2C[C@H]3CC[C@@H](C2)N3C(=O)OC(C)(C)C)c1.
What is the InChIKey of tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate?
The InChIKey is BWSLBNYBMHLMPP-FKEKPDDDSA-N. The full InChI is InChI=1S/C20H26FNO5/c1-20(2,3)27-19(24)22-14-5-6-15(22)11-17(10-14)26-16-8-12(18(23)25-4)7-13(21)9-16/h7-9,14-15,17H,5-6,10-11H2,1-4H3/t14-,15+,17?.
What are the key properties of tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate?
tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate has a molecular weight of 379.43 g/mol, XLogP of 3.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (1S,5R)-3-(3-fluoro-5-methoxycarbonylphenoxy)-8-azabicyclo[3.2.1]octane-8-carboxylate is sourced from PubChem (CID 70661600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).