C18H14IN3O2 — CID 70661756
(2'R,3R)-2'-(3-iodo-5-methoxy-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one (PubChem CID 70661756) has the molecular formula C18H14IN3O2 and a molecular weight of 431.23 g/mol. Its IUPAC name is (2'R,3R)-2'-(3-iodo-5-methoxy-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one.
| Compound Name | (2'R,3R)-2'-(3-iodo-5-methoxy-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
|---|---|
| PubChem CID | 70661756 |
| Molecular Formula | C18H14IN3O2 |
| Molecular Weight | 431.23 g/mol |
| Exact Mass | 431.01 |
| IUPAC Name | (2'R,3R)-2'-(3-iodo-5-methoxy-2H-indazol-6-yl)spiro[1H-indole-3,1'-cyclopropane]-2-one |
| SMILES | COc1cc2c(I)[nH]nc2cc1[C@H]1C[C@@]12C(=O)Nc1ccccc12 |
| InChI | InChI=1S/C18H14IN3O2/c1-24-15-7-10-14(21-22-16(10)19)6-9(15)12-8-18(12)11-4-2-3-5-13(11)20-17(18)23/h2-7,12H,8H2,1H3,(H,20,23)(H,21,22)/t12-,18+/m1/s1 |
| InChIKey | AQNASPMGBHYZJA-XIKOKIGWSA-N |
| XLogP | 3.55 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.23 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|