C8H14N2O3 — CID 70661848
(3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid (PubChem CID 70661848) has the molecular formula C8H14N2O3 and a molecular weight of 186.21 g/mol. Its IUPAC name is (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid.
| Compound Name | (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
|---|---|
| PubChem CID | 70661848 |
| Molecular Formula | C8H14N2O3 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | (3aR,6aR)-3a-methoxy-1,2,3,4,6,6a-hexahydropyrrolo[2,3-c]pyrrole-5-carboxylic acid |
| SMILES | CO[C@@]12CCN[C@@H]1CN(C(=O)O)C2 |
| InChI | InChI=1S/C8H14N2O3/c1-13-8-2-3-9-6(8)4-10(5-8)7(11)12/h6,9H,2-5H2,1H3,(H,11,12)/t6-,8-/m1/s1 |
| InChIKey | PPWVFDLWIKASFK-HTRCEHHLSA-N |
| XLogP | -0.27 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |