C29H30N4O4 — CID 70662776
3-[[3-[3-(dimethylamino)propoxy]phenyl]methylidene]-6-[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine-2,5-dione (PubChem CID 70662776) has the molecular formula C29H30N4O4 and a molecular weight of 498.58 g/mol. Its IUPAC name is 3-[[3-[3-(dimethylamino)propoxy]phenyl]methylidene]-6-[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine-2,5-dione.
| Compound Name | 3-[[3-[3-(dimethylamino)propoxy]phenyl]methylidene]-6-[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine-2,5-dione |
|---|---|
| PubChem CID | 70662776 |
| Molecular Formula | C29H30N4O4 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.23 |
| IUPAC Name | 3-[[3-[3-(dimethylamino)propoxy]phenyl]methylidene]-6-[(5-phenylmethoxy-2-pyridinyl)methylidene]piperazine-2,5-dione |
| SMILES | CN(C)CCCOc1cccc(C=c2[nH]c(=O)c(=Cc3ccc(OCc4ccccc4)cn3)[nH]c2=O)c1 |
| InChI | InChI=1S/C29H30N4O4/c1-33(2)14-7-15-36-24-11-6-10-22(16-24)17-26-28(34)32-27(29(35)31-26)18-23-12-13-25(19-30-23)37-20-21-8-4-3-5-9-21/h3-6,8-13,16-19H,7,14-15,20H2,1-2H3,(H,31,35)(H,32,34) |
| InChIKey | YPOPBRNUOCMWAA-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 100.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|