C29H37BN4O5 — CID 70664048
[(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid (PubChem CID 70664048) has the molecular formula C29H37BN4O5 and a molecular weight of 532.45 g/mol. Its IUPAC name is [(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid.
| Compound Name | [(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 70664048 |
| Molecular Formula | C29H37BN4O5 |
| Molecular Weight | 532.45 g/mol |
| Exact Mass | 532.29 |
| IUPAC Name | [(2S)-3-methyl-1-oxo-1-[(2S)-2-[5-[6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalen-2-yl]-4H-imidazol-2-yl]pyrrolidin-1-yl]butan-2-yl]carbamic acid |
| SMILES | CC(C)[C@H](NC(=O)O)C(=O)N1CCC[C@H]1C1=NCC(c2ccc3cc(B4OC(C)(C)C(C)(C)O4)ccc3c2)=N1 |
| InChI | InChI=1S/C29H37BN4O5/c1-17(2)24(33-27(36)37)26(35)34-13-7-8-23(34)25-31-16-22(32-25)20-10-9-19-15-21(12-11-18(19)14-20)30-38-28(3,4)29(5,6)39-30/h9-12,14-15,17,23-24,33H,7-8,13,16H2,1-6H3,(H,36,37)/t23-,24-/m0/s1 |
| InChIKey | KOLXBNBEZFQMMR-ZEQRLZLVSA-N |
| XLogP | 3.62 |
| TPSA | 112.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.45 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|