C11H17BN3O — CID 70665658
CID 70665658 (PubChem CID 70665658) has the molecular formula C11H17BN3O and a molecular weight of 218.09 g/mol.
| Compound Name | CID 70665658 |
|---|---|
| PubChem CID | 70665658 |
| Molecular Formula | C11H17BN3O |
| Molecular Weight | 218.09 g/mol |
| Exact Mass | 218.15 |
| IUPAC Name | — |
| SMILES | [B]=C1CCC(C)(CC)C1(O)Cn1cncn1 |
| InChI | InChI=1S/C11H17BN3O/c1-3-10(2)5-4-9(12)11(10,16)6-15-8-13-7-14-15/h7-8,16H,3-6H2,1-2H3 |
| InChIKey | XKMBYIROGQQFKT-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.09 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|