C12H16O5 — CID 70665872
(1'S,5'S)-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one (PubChem CID 70665872) has the molecular formula C12H16O5 and a molecular weight of 240.25 g/mol. Its IUPAC name is (1'S,5'S)-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one.
| Compound Name | (1'S,5'S)-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
|---|---|
| PubChem CID | 70665872 |
| Molecular Formula | C12H16O5 |
| Molecular Weight | 240.25 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | (1'S,5'S)-5'-(ethoxymethyl)spiro[1,3-dioxolane-2,4'-8-oxabicyclo[3.2.1]oct-6-ene]-2'-one |
| SMILES | CCOC[C@]12C=C[C@H](O1)C(=O)CC21OCCO1 |
| InChI | InChI=1S/C12H16O5/c1-2-14-8-11-4-3-10(17-11)9(13)7-12(11)15-5-6-16-12/h3-4,10H,2,5-8H2,1H3/t10-,11-/m0/s1 |
| InChIKey | ZEXSGZCWEISNAA-QWRGUYRKSA-N |
| XLogP | 0.43 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.25 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|