About 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one
5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one (PubChem CID 70666004) has the molecular formula C7H8N4O
and a molecular weight of 164.17 g/mol. Its IUPAC name is 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one.
Molecular Properties
| Compound Name | 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one |
| PubChem CID | 70666004 |
| Molecular Formula | C7H8N4O |
| Molecular Weight | 164.17 g/mol |
| Exact Mass | 164.07 |
| IUPAC Name | 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one |
| SMILES | Cc1nc2cn[nH]c2c(=O)n1C |
| InChI | InChI=1S/C7H8N4O/c1-4-9-5-3-8-10-6(5)7(12)11(4)2/h3H,1-2H3,(H,8,10) |
| InChIKey | QCZIYWHTUIREAU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 63.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.17 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one?
The IUPAC name of 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one (CID 70666004) is 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one.
What is the SMILES notation for 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one?
The canonical SMILES for 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one is Cc1nc2cn[nH]c2c(=O)n1C.
What is the InChIKey of 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one?
The InChIKey is QCZIYWHTUIREAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8N4O/c1-4-9-5-3-8-10-6(5)7(12)11(4)2/h3H,1-2H3,(H,8,10).
What are the key properties of 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one?
5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one has a molecular weight of 164.17 g/mol, XLogP of -0.03, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dimethyl-1H-pyrazolo[4,5-d]pyrimidin-7-one is sourced from PubChem (CID 70666004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).