About 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine
2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine (PubChem CID 70666053) has the molecular formula C12H21N
and a molecular weight of 179.31 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine.
Molecular Properties
| Compound Name | 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine |
| PubChem CID | 70666053 |
| Molecular Formula | C12H21N |
| Molecular Weight | 179.31 g/mol |
| Exact Mass | 179.17 |
| IUPAC Name | 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine |
| SMILES | CC(C)C1=CCCC(C(C)C)=C1N |
| InChI | InChI=1S/C12H21N/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h6,8-9H,5,7,13H2,1-4H3 |
| InChIKey | VZPAZWFJUWCGNK-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.31 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The IUPAC name of 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine (CID 70666053) is 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine.
What is the SMILES notation for 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The canonical SMILES for 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine is CC(C)C1=CCCC(C(C)C)=C1N.
What is the InChIKey of 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
The InChIKey is VZPAZWFJUWCGNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N/c1-8(2)10-6-5-7-11(9(3)4)12(10)13/h6,8-9H,5,7,13H2,1-4H3.
What are the key properties of 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine?
2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine has a molecular weight of 179.31 g/mol, XLogP of 3.23, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-di(propan-2-yl)cyclohexa-1,5-dien-1-amine is sourced from PubChem (CID 70666053), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).