C19H23NO2 — CID 70666538
cyclopentyl-[(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]methanone (PubChem CID 70666538) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is cyclopentyl-[(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]methanone.
| Compound Name | cyclopentyl-[(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]methanone |
|---|---|
| PubChem CID | 70666538 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | cyclopentyl-[(1R,9R,13S)-4-hydroxy-1-methyl-10-azatetracyclo[7.3.1.02,7.011,13]trideca-2(7),3,5-trien-10-yl]methanone |
| SMILES | C[C@@]12CC3[C@H]1[C@@H](Cc1ccc(O)cc12)N3C(=O)C1CCCC1 |
| InChI | InChI=1S/C19H23NO2/c1-19-10-16-17(19)15(8-12-6-7-13(21)9-14(12)19)20(16)18(22)11-4-2-3-5-11/h6-7,9,11,15-17,21H,2-5,8,10H2,1H3/t15-,16?,17-,19+/m1/s1 |
| InChIKey | KFVKCOWOAOVJNU-OJUYECANSA-N |
| XLogP | 3.00 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |