C11H19N3O3 — CID 70667200
1-tert-butyl-3,5-diethyl-1,3,5-triazinane-2,4,6-trione (PubChem CID 70667200) has the molecular formula C11H19N3O3 and a molecular weight of 241.29 g/mol. Its IUPAC name is 1-tert-butyl-3,5-diethyl-1,3,5-triazinane-2,4,6-trione.
| Compound Name | 1-tert-butyl-3,5-diethyl-1,3,5-triazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70667200 |
| Molecular Formula | C11H19N3O3 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.14 |
| IUPAC Name | 1-tert-butyl-3,5-diethyl-1,3,5-triazinane-2,4,6-trione |
| SMILES | CCn1c(=O)n(CC)c(=O)n(C(C)(C)C)c1=O |
| InChI | InChI=1S/C11H19N3O3/c1-6-12-8(15)13(7-2)10(17)14(9(12)16)11(3,4)5/h6-7H2,1-5H3 |
| InChIKey | ZMBMNEVDILSGTC-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 66.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |