About 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine
4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine (PubChem CID 70667644) has the molecular formula C9H12N4
and a molecular weight of 176.22 g/mol. Its IUPAC name is 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine.
Molecular Properties
| Compound Name | 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine |
| PubChem CID | 70667644 |
| Molecular Formula | C9H12N4 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.11 |
| IUPAC Name | 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine |
| SMILES | CCc1nc(CC)c2cn[nH]c2n1 |
| InChI | InChI=1S/C9H12N4/c1-3-7-6-5-10-13-9(6)12-8(4-2)11-7/h5H,3-4H2,1-2H3,(H,10,11,12,13) |
| InChIKey | KEYRIOAXNRPNBN-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine?
The IUPAC name of 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine (CID 70667644) is 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine.
What is the SMILES notation for 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine?
The canonical SMILES for 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine is CCc1nc(CC)c2cn[nH]c2n1.
What is the InChIKey of 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine?
The InChIKey is KEYRIOAXNRPNBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4/c1-3-7-6-5-10-13-9(6)12-8(4-2)11-7/h5H,3-4H2,1-2H3,(H,10,11,12,13).
What are the key properties of 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine?
4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine has a molecular weight of 176.22 g/mol, XLogP of 1.48, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-diethyl-1H-pyrazolo[3,4-d]pyrimidine is sourced from PubChem (CID 70667644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).