C50H38N4 — CID 70667674
2-[4-[4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthrolin-2-yl]phenyl]-4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthroline (PubChem CID 70667674) has the molecular formula C50H38N4 and a molecular weight of 694.88 g/mol. Its IUPAC name is 2-[4-[4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthrolin-2-yl]phenyl]-4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthroline.
| Compound Name | 2-[4-[4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthrolin-2-yl]phenyl]-4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthroline |
|---|---|
| PubChem CID | 70667674 |
| Molecular Formula | C50H38N4 |
| Molecular Weight | 694.88 g/mol |
| Exact Mass | 694.31 |
| IUPAC Name | 2-[4-[4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthrolin-2-yl]phenyl]-4,7-dimethyl-9-[(E)-2-phenylethenyl]-1,10-phenanthroline |
| SMILES | Cc1cc(/C=C/c2ccccc2)nc2c1ccc1c(C)cc(-c3ccc(-c4cc(C)c5ccc6c(C)cc(/C=C/c7ccccc7)nc6c5n4)cc3)nc12 |
| InChI | InChI=1S/C50H38N4/c1-31-27-39(21-15-35-11-7-5-8-12-35)51-47-41(31)23-25-43-33(3)29-45(53-49(43)47)37-17-19-38(20-18-37)46-30-34(4)44-26-24-42-32(2)28-40(52-48(42)50(44)54-46)22-16-36-13-9-6-10-14-36/h5-30H,1-4H3/b21-15+,22-16+ |
| InChIKey | XOCNXSBRJDZKNH-YHARCJFQSA-N |
| XLogP | 12.79 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 694.88 |
| LogP ≤ 5 | 12.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|