About 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine
6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine (PubChem CID 7066869) has the molecular formula C19H16ClN3S
and a molecular weight of 353.88 g/mol. Its IUPAC name is 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine.
Molecular Properties
| Compound Name | 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine |
| PubChem CID | 7066869 |
| Molecular Formula | C19H16ClN3S |
| Molecular Weight | 353.88 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine |
| SMILES | Cc1cccc(C)c1Nc1c(-c2ccsc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C19H16ClN3S/c1-12-4-3-5-13(2)17(12)22-19-18(14-8-9-24-11-14)21-16-7-6-15(20)10-23(16)19/h3-11,22H,1-2H3 |
| InChIKey | SDTGAVAHJQVLOT-UHFFFAOYSA-N |
| XLogP | 6.08 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 353.88 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine?
The IUPAC name of 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine (CID 7066869) is 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine.
What is the SMILES notation for 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine?
The canonical SMILES for 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine is Cc1cccc(C)c1Nc1c(-c2ccsc2)nc2ccc(Cl)cn12.
What is the InChIKey of 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine?
The InChIKey is SDTGAVAHJQVLOT-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16ClN3S/c1-12-4-3-5-13(2)17(12)22-19-18(14-8-9-24-11-14)21-16-7-6-15(20)10-23(16)19/h3-11,22H,1-2H3.
What are the key properties of 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine?
6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine has a molecular weight of 353.88 g/mol, XLogP of 6.08, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-chloro-N-(2,6-dimethylphenyl)-2-thiophen-3-ylimidazo[1,2-a]pyridin-3-amine is sourced from PubChem (CID 7066869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).