C24H27FN6O2 — CID 70669166
benzyl N-[(3S,6R)-1-[2-amino-6-(4-amino-3-fluorophenyl)pyrimidin-4-yl]-6-methylpiperidin-3-yl]carbamate (PubChem CID 70669166) has the molecular formula C24H27FN6O2 and a molecular weight of 450.52 g/mol. Its IUPAC name is benzyl N-[(3S,6R)-1-[2-amino-6-(4-amino-3-fluorophenyl)pyrimidin-4-yl]-6-methylpiperidin-3-yl]carbamate.
| Compound Name | benzyl N-[(3S,6R)-1-[2-amino-6-(4-amino-3-fluorophenyl)pyrimidin-4-yl]-6-methylpiperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70669166 |
| Molecular Formula | C24H27FN6O2 |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.22 |
| IUPAC Name | benzyl N-[(3S,6R)-1-[2-amino-6-(4-amino-3-fluorophenyl)pyrimidin-4-yl]-6-methylpiperidin-3-yl]carbamate |
| SMILES | C[C@@H]1CC[C@H](NC(=O)OCc2ccccc2)CN1c1cc(-c2ccc(N)c(F)c2)nc(N)n1 |
| InChI | InChI=1S/C24H27FN6O2/c1-15-7-9-18(28-24(32)33-14-16-5-3-2-4-6-16)13-31(15)22-12-21(29-23(27)30-22)17-8-10-20(26)19(25)11-17/h2-6,8,10-12,15,18H,7,9,13-14,26H2,1H3,(H,28,32)(H2,27,29,30)/t15-,18+/m1/s1 |
| InChIKey | ZKXMNKOTZOAEAU-QAPCUYQASA-N |
| XLogP | 3.73 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|