About 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide
5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide (PubChem CID 70669437) has the molecular formula C10H14N2O2S
and a molecular weight of 226.30 g/mol. Its IUPAC name is 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide.
Molecular Properties
| Compound Name | 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide |
| PubChem CID | 70669437 |
| Molecular Formula | C10H14N2O2S |
| Molecular Weight | 226.30 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide |
| SMILES | Cc1cnc(C(=O)NC2CCOCC2)s1 |
| InChI | InChI=1S/C10H14N2O2S/c1-7-6-11-10(15-7)9(13)12-8-2-4-14-5-3-8/h6,8H,2-5H2,1H3,(H,12,13) |
| InChIKey | JXFCNYGQHPIKCI-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.30 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide?
The IUPAC name of 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide (CID 70669437) is 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide.
What is the SMILES notation for 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide?
The canonical SMILES for 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide is Cc1cnc(C(=O)NC2CCOCC2)s1.
What is the InChIKey of 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide?
The InChIKey is JXFCNYGQHPIKCI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H14N2O2S/c1-7-6-11-10(15-7)9(13)12-8-2-4-14-5-3-8/h6,8H,2-5H2,1H3,(H,12,13).
What are the key properties of 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide?
5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide has a molecular weight of 226.30 g/mol, XLogP of 1.36, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-methyl-N-(oxan-4-yl)-1,3-thiazole-2-carboxamide is sourced from PubChem (CID 70669437), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).