C11H13N3O2 — CID 70669514
1-(3,5-diaminophenyl)-3-methylpyrrolidine-2,5-dione (PubChem CID 70669514) has the molecular formula C11H13N3O2 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-(3,5-diaminophenyl)-3-methylpyrrolidine-2,5-dione.
| Compound Name | 1-(3,5-diaminophenyl)-3-methylpyrrolidine-2,5-dione |
|---|---|
| PubChem CID | 70669514 |
| Molecular Formula | C11H13N3O2 |
| Molecular Weight | 219.24 g/mol |
| Exact Mass | 219.10 |
| IUPAC Name | 1-(3,5-diaminophenyl)-3-methylpyrrolidine-2,5-dione |
| SMILES | CC1CC(=O)N(c2cc(N)cc(N)c2)C1=O |
| InChI | InChI=1S/C11H13N3O2/c1-6-2-10(15)14(11(6)16)9-4-7(12)3-8(13)5-9/h3-6H,2,12-13H2,1H3 |
| InChIKey | GHBJCASWFWFYGD-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 89.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.24 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|