C6H12N2O2 — CID 70670068
(2S,3R,6S)-3-amino-6-(aminomethyl)-3,6-dihydro-2H-pyran-2-ol (PubChem CID 70670068) has the molecular formula C6H12N2O2 and a molecular weight of 144.17 g/mol. Its IUPAC name is (2S,3R,6S)-3-amino-6-(aminomethyl)-3,6-dihydro-2H-pyran-2-ol.
| Compound Name | (2S,3R,6S)-3-amino-6-(aminomethyl)-3,6-dihydro-2H-pyran-2-ol |
|---|---|
| PubChem CID | 70670068 |
| Molecular Formula | C6H12N2O2 |
| Molecular Weight | 144.17 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | (2S,3R,6S)-3-amino-6-(aminomethyl)-3,6-dihydro-2H-pyran-2-ol |
| SMILES | NC[C@@H]1C=C[C@@H](N)[C@@H](O)O1 |
| InChI | InChI=1S/C6H12N2O2/c7-3-4-1-2-5(8)6(9)10-4/h1-2,4-6,9H,3,7-8H2/t4-,5+,6-/m0/s1 |
| InChIKey | SPSIACVJTFUESN-JKUQZMGJSA-N |
| XLogP | -1.45 |
| TPSA | 81.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 144.17 |
| LogP ≤ 5 | -1.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|