C14H15N — CID 70670077
1,9,10,10a-tetrahydrophenanthren-9-amine (PubChem CID 70670077) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 1,9,10,10a-tetrahydrophenanthren-9-amine.
| Compound Name | 1,9,10,10a-tetrahydrophenanthren-9-amine |
|---|---|
| PubChem CID | 70670077 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 1,9,10,10a-tetrahydrophenanthren-9-amine |
| SMILES | NC1CC2CC=CC=C2c2ccccc21 |
| InChI | InChI=1S/C14H15N/c15-14-9-10-5-1-2-6-11(10)12-7-3-4-8-13(12)14/h1-4,6-8,10,14H,5,9,15H2 |
| InChIKey | LLANNOYTRIUAQU-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |