C13H17F3N2OS — CID 70670169
methyl 3-[2-(dimethylamino)ethoxy]-5-(trifluoromethyl)benzenecarboximidothioate (PubChem CID 70670169) has the molecular formula C13H17F3N2OS and a molecular weight of 306.35 g/mol. Its IUPAC name is methyl 3-[2-(dimethylamino)ethoxy]-5-(trifluoromethyl)benzenecarboximidothioate.
| Compound Name | methyl 3-[2-(dimethylamino)ethoxy]-5-(trifluoromethyl)benzenecarboximidothioate |
|---|---|
| PubChem CID | 70670169 |
| Molecular Formula | C13H17F3N2OS |
| Molecular Weight | 306.35 g/mol |
| Exact Mass | 306.10 |
| IUPAC Name | methyl 3-[2-(dimethylamino)ethoxy]-5-(trifluoromethyl)benzenecarboximidothioate |
| SMILES | [H]/N=C(\SC)c1cc(OCCN(C)C)cc(C(F)(F)F)c1 |
| InChI | InChI=1S/C13H17F3N2OS/c1-18(2)4-5-19-11-7-9(12(17)20-3)6-10(8-11)13(14,15)16/h6-8,17H,4-5H2,1-3H3/b17-12- |
| InChIKey | PXPGFQZAMRCOBI-ATVHPVEESA-N |
| XLogP | 3.33 |
| TPSA | 36.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.35 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|