About 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine
3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine (PubChem CID 70670335) has the molecular formula C19H18IN
and a molecular weight of 387.26 g/mol. Its IUPAC name is 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine.
Molecular Properties
| Compound Name | 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine |
| PubChem CID | 70670335 |
| Molecular Formula | C19H18IN |
| Molecular Weight | 387.26 g/mol |
| Exact Mass | 387.05 |
| IUPAC Name | 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine |
| SMILES | CC1=C(c2cccc(-c3cccnc3)c2)C[C@](C)(I)C=C1 |
| InChI | InChI=1S/C19H18IN/c1-14-8-9-19(2,20)12-18(14)16-6-3-5-15(11-16)17-7-4-10-21-13-17/h3-11,13H,12H2,1-2H3/t19-/m1/s1 |
| InChIKey | FBTIATOJHFIYFZ-LJQANCHMSA-N |
| XLogP | 5.68 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 387.26 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine?
The IUPAC name of 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine (CID 70670335) is 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine.
What is the SMILES notation for 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine?
The canonical SMILES for 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine is CC1=C(c2cccc(-c3cccnc3)c2)C[C@](C)(I)C=C1.
What is the InChIKey of 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine?
The InChIKey is FBTIATOJHFIYFZ-LJQANCHMSA-N. The full InChI is InChI=1S/C19H18IN/c1-14-8-9-19(2,20)12-18(14)16-6-3-5-15(11-16)17-7-4-10-21-13-17/h3-11,13H,12H2,1-2H3/t19-/m1/s1.
What are the key properties of 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine?
3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine has a molecular weight of 387.26 g/mol, XLogP of 5.68, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[3-[(5S)-5-iodo-2,5-dimethylcyclohexa-1,3-dien-1-yl]phenyl]pyridine is sourced from PubChem (CID 70670335), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).