C23H20ClFO3 — CID 70670348
4-[5-(5-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2-dimethyl-6-methylidenecyclohex-4-ene-1,3-dione (PubChem CID 70670348) has the molecular formula C23H20ClFO3 and a molecular weight of 398.86 g/mol. Its IUPAC name is 4-[5-(5-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2-dimethyl-6-methylidenecyclohex-4-ene-1,3-dione.
| Compound Name | 4-[5-(5-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2-dimethyl-6-methylidenecyclohex-4-ene-1,3-dione |
|---|---|
| PubChem CID | 70670348 |
| Molecular Formula | C23H20ClFO3 |
| Molecular Weight | 398.86 g/mol |
| Exact Mass | 398.11 |
| IUPAC Name | 4-[5-(5-chloro-2-fluorophenyl)-2-ethylphenyl]-5-hydroxy-2,2-dimethyl-6-methylidenecyclohex-4-ene-1,3-dione |
| SMILES | C=C1C(=O)C(C)(C)C(=O)C(c2cc(-c3cc(Cl)ccc3F)ccc2CC)=C1O |
| InChI | InChI=1S/C23H20ClFO3/c1-5-13-6-7-14(16-11-15(24)8-9-18(16)25)10-17(13)19-20(26)12(2)21(27)23(3,4)22(19)28/h6-11,26H,2,5H2,1,3-4H3 |
| InChIKey | LDEWFRMTQLJCQB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.86 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|