About 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one
3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one (PubChem CID 70670413) has the molecular formula C22H22F3N3O2
and a molecular weight of 417.43 g/mol. Its IUPAC name is 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one.
Molecular Properties
| Compound Name | 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one |
| PubChem CID | 70670413 |
| Molecular Formula | C22H22F3N3O2 |
| Molecular Weight | 417.43 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one |
| SMILES | CC(=O)c1cn(C(C)C)c2c(F)c(NCCc3ccc(F)cc3)c(F)c(N)c2c1=O |
| InChI | InChI=1S/C22H22F3N3O2/c1-11(2)28-10-15(12(3)29)22(30)16-19(26)17(24)20(18(25)21(16)28)27-9-8-13-4-6-14(23)7-5-13/h4-7,10-11,27H,8-9,26H2,1-3H3 |
| InChIKey | SOOISYDDGJOQJQ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 77.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 417.43 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one?
The IUPAC name of 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one (CID 70670413) is 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one.
What is the SMILES notation for 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one?
The canonical SMILES for 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one is CC(=O)c1cn(C(C)C)c2c(F)c(NCCc3ccc(F)cc3)c(F)c(N)c2c1=O.
What is the InChIKey of 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one?
The InChIKey is SOOISYDDGJOQJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H22F3N3O2/c1-11(2)28-10-15(12(3)29)22(30)16-19(26)17(24)20(18(25)21(16)28)27-9-8-13-4-6-14(23)7-5-13/h4-7,10-11,27H,8-9,26H2,1-3H3.
What are the key properties of 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one?
3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one has a molecular weight of 417.43 g/mol, XLogP of 4.44, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-acetyl-5-amino-6,8-difluoro-7-[2-(4-fluorophenyl)ethylamino]-1-propan-2-ylquinolin-4-one is sourced from PubChem (CID 70670413), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).