C25H29N3O4S — CID 70670501
N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,1-dioxothian-4-yl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-amine (PubChem CID 70670501) has the molecular formula C25H29N3O4S and a molecular weight of 467.59 g/mol. Its IUPAC name is N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,1-dioxothian-4-yl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-amine.
| Compound Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,1-dioxothian-4-yl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-amine |
|---|---|
| PubChem CID | 70670501 |
| Molecular Formula | C25H29N3O4S |
| Molecular Weight | 467.59 g/mol |
| Exact Mass | 467.19 |
| IUPAC Name | N-(2,3-dihydro-1,4-benzodioxin-6-yl)-2-(1,1-dioxothian-4-yl)-5-methyl-3,4-dihydro-1H-pyrido[4,3-b]indol-8-amine |
| SMILES | Cn1c2c(c3cc(Nc4ccc5c(c4)OCCO5)ccc31)CN(C1CCS(=O)(=O)CC1)CC2 |
| InChI | InChI=1S/C25H29N3O4S/c1-27-22-4-2-17(26-18-3-5-24-25(15-18)32-11-10-31-24)14-20(22)21-16-28(9-6-23(21)27)19-7-12-33(29,30)13-8-19/h2-5,14-15,19,26H,6-13,16H2,1H3 |
| InChIKey | KUHJWPLRRMADOC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 72.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.59 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|