About 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate
4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate (PubChem CID 70670539) has the molecular formula C15H22O8
and a molecular weight of 330.33 g/mol. Its IUPAC name is 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate.
Molecular Properties
| Compound Name | 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate |
| PubChem CID | 70670539 |
| Molecular Formula | C15H22O8 |
| Molecular Weight | 330.33 g/mol |
| Exact Mass | 330.13 |
| IUPAC Name | 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate |
| SMILES | C=C1OC(C(O)COC(=O)CCC(=O)OC(C)(C)C)C(O)=C1O |
| InChI | InChI=1S/C15H22O8/c1-8-12(19)13(20)14(22-8)9(16)7-21-10(17)5-6-11(18)23-15(2,3)4/h9,14,16,19-20H,1,5-7H2,2-4H3 |
| InChIKey | AVGMNOXMDLLZEQ-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.33 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate?
The IUPAC name of 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate (CID 70670539) is 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate.
What is the SMILES notation for 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate?
The canonical SMILES for 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate is C=C1OC(C(O)COC(=O)CCC(=O)OC(C)(C)C)C(O)=C1O.
What is the InChIKey of 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate?
The InChIKey is AVGMNOXMDLLZEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O8/c1-8-12(19)13(20)14(22-8)9(16)7-21-10(17)5-6-11(18)23-15(2,3)4/h9,14,16,19-20H,1,5-7H2,2-4H3.
What are the key properties of 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate?
4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate has a molecular weight of 330.33 g/mol, XLogP of 1.25, 6 rotatable bonds, 3 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-O-tert-butyl 1-O-[2-(3,4-dihydroxy-5-methylidene-2H-furan-2-yl)-2-hydroxyethyl] butanedioate is sourced from PubChem (CID 70670539), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).