C9H10NO3S- — CID 70670718
(4-carbamoyl-2-methylphenyl)methanesulfinate (PubChem CID 70670718) has the molecular formula C9H10NO3S- and a molecular weight of 212.25 g/mol. Its IUPAC name is (4-carbamoyl-2-methylphenyl)methanesulfinate.
| Compound Name | (4-carbamoyl-2-methylphenyl)methanesulfinate |
|---|---|
| PubChem CID | 70670718 |
| Molecular Formula | C9H10NO3S- |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.04 |
| IUPAC Name | (4-carbamoyl-2-methylphenyl)methanesulfinate |
| SMILES | Cc1cc(C(N)=O)ccc1CS(=O)[O-] |
| InChI | InChI=1S/C9H11NO3S/c1-6-4-7(9(10)11)2-3-8(6)5-14(12)13/h2-4H,5H2,1H3,(H2,10,11)(H,12,13)/p-1 |
| InChIKey | ZUTAJQYBKQFKPX-UHFFFAOYSA-M |
| XLogP | 0.47 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'} |
|---|