C14H23NO4 — CID 70671267
(1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-1,2-dimethyl-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671267) has the molecular formula C14H23NO4 and a molecular weight of 269.34 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-1,2-dimethyl-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-1,2-dimethyl-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671267 |
| Molecular Formula | C14H23NO4 |
| Molecular Weight | 269.34 g/mol |
| Exact Mass | 269.16 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-4-hydroxy-1,2-dimethyl-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(C)N1C(=O)[C@@H]1CC(O)O[C@@]12C |
| InChI | InChI=1S/C14H23NO4/c1-12(2,3)11-15-10(17)8-6-9(16)19-14(8,5)13(15,4)7-18-11/h8-9,11,16H,6-7H2,1-5H3/t8-,9?,11-,13-,14-/m0/s1 |
| InChIKey | RFLAGRPGPHBQCV-BNZIQLGESA-N |
| XLogP | 1.10 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.34 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |