C21H29NO4 — CID 70671268
(1S,2S,6R,9S)-9-tert-butyl-1,2-dimethyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671268) has the molecular formula C21H29NO4 and a molecular weight of 359.47 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-1,2-dimethyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-1,2-dimethyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671268 |
| Molecular Formula | C21H29NO4 |
| Molecular Weight | 359.47 g/mol |
| Exact Mass | 359.21 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-1,2-dimethyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2(C)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C21H29NO4/c1-19(2,3)18-22-17(23)15-11-16(24-12-14-9-7-6-8-10-14)26-21(15,5)20(22,4)13-25-18/h6-10,15-16,18H,11-13H2,1-5H3/t15-,16?,18-,20-,21-/m0/s1 |
| InChIKey | LMOUKPRBLJKREF-GDEPEFMTSA-N |
| XLogP | 3.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |