C22H29NO6 — CID 70671269
methyl (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate (PubChem CID 70671269) has the molecular formula C22H29NO6 and a molecular weight of 403.48 g/mol. Its IUPAC name is methyl (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate.
| Compound Name | methyl (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
|---|---|
| PubChem CID | 70671269 |
| Molecular Formula | C22H29NO6 |
| Molecular Weight | 403.48 g/mol |
| Exact Mass | 403.20 |
| IUPAC Name | methyl (1S,2S,6R,9S)-9-tert-butyl-2-methyl-7-oxo-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecane-1-carboxylate |
| SMILES | COC(=O)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C22H29NO6/c1-20(2,3)18-23-17(24)15-11-16(27-12-14-9-7-6-8-10-14)29-21(15,4)22(23,13-28-18)19(25)26-5/h6-10,15-16,18H,11-13H2,1-5H3/t15-,16?,18-,21-,22+/m0/s1 |
| InChIKey | FHZXHALDAKNXNH-CBSJCMDRSA-N |
| XLogP | 2.48 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.48 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |