C22H31NO4 — CID 70671270
(1S,2S,6R,9S)-9-tert-butyl-1-ethyl-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671270) has the molecular formula C22H31NO4 and a molecular weight of 373.49 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-1-ethyl-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-1-ethyl-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671270 |
| Molecular Formula | C22H31NO4 |
| Molecular Weight | 373.49 g/mol |
| Exact Mass | 373.23 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-1-ethyl-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C22H31NO4/c1-6-22-14-26-19(20(2,3)4)23(22)18(24)16-12-17(27-21(16,22)5)25-13-15-10-8-7-9-11-15/h7-11,16-17,19H,6,12-14H2,1-5H3/t16-,17?,19-,21-,22-/m0/s1 |
| InChIKey | WYIZKPMYENEQDC-DYKQHQKNSA-N |
| XLogP | 3.72 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |