C27H37NO5 — CID 70671278
(1R,2S,6R,9S)-9-tert-butyl-1-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671278) has the molecular formula C27H37NO5 and a molecular weight of 455.60 g/mol. Its IUPAC name is (1R,2S,6R,9S)-9-tert-butyl-1-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1R,2S,6R,9S)-9-tert-butyl-1-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671278 |
| Molecular Formula | C27H37NO5 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.27 |
| IUPAC Name | (1R,2S,6R,9S)-9-tert-butyl-1-[(R)-[(1S)-cyclohex-2-en-1-yl]-hydroxymethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | CC(C)(C)[C@@H]1OC[C@]2([C@H](O)[C@@H]3C=CCCC3)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C27H37NO5/c1-25(2,3)24-28-23(30)20-15-21(31-16-18-11-7-5-8-12-18)33-26(20,4)27(28,17-32-24)22(29)19-13-9-6-10-14-19/h5,7-9,11-13,19-22,24,29H,6,10,14-17H2,1-4H3/t19-,20+,21?,22-,24+,26+,27-/m1/s1 |
| InChIKey | BHPMLOQWSUDNRI-BHSQVJKYSA-N |
| XLogP | 4.03 |
| TPSA | 68.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|