C28H39NO4 — CID 70671281
(1S,2S,6R,9S)-9-tert-butyl-1-[(1R)-1-[(1S)-cyclohex-2-en-1-yl]ethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one (PubChem CID 70671281) has the molecular formula C28H39NO4 and a molecular weight of 453.62 g/mol. Its IUPAC name is (1S,2S,6R,9S)-9-tert-butyl-1-[(1R)-1-[(1S)-cyclohex-2-en-1-yl]ethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one.
| Compound Name | (1S,2S,6R,9S)-9-tert-butyl-1-[(1R)-1-[(1S)-cyclohex-2-en-1-yl]ethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
|---|---|
| PubChem CID | 70671281 |
| Molecular Formula | C28H39NO4 |
| Molecular Weight | 453.62 g/mol |
| Exact Mass | 453.29 |
| IUPAC Name | (1S,2S,6R,9S)-9-tert-butyl-1-[(1R)-1-[(1S)-cyclohex-2-en-1-yl]ethyl]-2-methyl-4-phenylmethoxy-3,10-dioxa-8-azatricyclo[6.3.0.02,6]undecan-7-one |
| SMILES | C[C@H]([C@@H]1C=CCCC1)[C@@]12CO[C@@H](C(C)(C)C)N1C(=O)[C@@H]1CC(OCc3ccccc3)O[C@@]12C |
| InChI | InChI=1S/C28H39NO4/c1-19(21-14-10-7-11-15-21)28-18-32-25(26(2,3)4)29(28)24(30)22-16-23(33-27(22,28)5)31-17-20-12-8-6-9-13-20/h6,8-10,12-14,19,21-23,25H,7,11,15-18H2,1-5H3/t19-,21-,22+,23?,25+,27+,28-/m1/s1 |
| InChIKey | ORHDHMSVTFKWJF-HIUWIQPDSA-N |
| XLogP | 5.30 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.62 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|